C35H39N3O4 — CID 161092913
(1R)-6,7-dimethoxy-1-[[6-[2-methoxy-4-[[(1R)-6-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]phenoxy]-3-pyridinyl]methyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 161092913) has the molecular formula C35H39N3O4 and a molecular weight of 565.71 g/mol. Its IUPAC name is (1R)-6,7-dimethoxy-1-[[6-[2-methoxy-4-[[(1R)-6-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]phenoxy]-3-pyridinyl]methyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-6,7-dimethoxy-1-[[6-[2-methoxy-4-[[(1R)-6-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]phenoxy]-3-pyridinyl]methyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 161092913 |
| Molecular Formula | C35H39N3O4 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | (1R)-6,7-dimethoxy-1-[[6-[2-methoxy-4-[[(1R)-6-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]phenoxy]-3-pyridinyl]methyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@@H](Cc1ccc(Oc3ccc(C[C@H]4NCCc5cc(C)ccc54)cc3OC)nc1)NCC2 |
| InChI | InChI=1S/C35H39N3O4/c1-22-5-8-27-25(15-22)11-13-36-29(27)16-23-6-9-31(32(18-23)39-2)42-35-10-7-24(21-38-35)17-30-28-20-34(41-4)33(40-3)19-26(28)12-14-37-30/h5-10,15,18-21,29-30,36-37H,11-14,16-17H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | UHKMFSNHMCKQMY-LOYHVIPDSA-N |
| XLogP | 6.07 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |