About 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one
1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one (PubChem CID 161093220) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one.
Molecular Properties
| Compound Name | 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one |
| PubChem CID | 161093220 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one |
| SMILES | CC(=O)C1CC1C.CCCC(C)=O.COCC(C)=O |
| InChI | InChI=1S/C6H10O.C5H10O.C4H8O2/c1-4-3-6(4)5(2)7;1-3-4-5(2)6;1-4(5)3-6-2/h4,6H,3H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | UHLKTDNQHOFEHM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one?
The IUPAC name of 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one (CID 161093220) is 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one.
What is the SMILES notation for 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one?
The canonical SMILES for 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one is CC(=O)C1CC1C.CCCC(C)=O.COCC(C)=O.
What is the InChIKey of 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one?
The InChIKey is UHLKTDNQHOFEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C5H10O.C4H8O2/c1-4-3-6(4)5(2)7;1-3-4-5(2)6;1-4(5)3-6-2/h4,6H,3H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one?
1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one has a molecular weight of 272.38 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-one;1-(2-methylcyclopropyl)ethanone;pentan-2-one is sourced from PubChem (CID 161093220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).