C35H39N5O2 — CID 161095100
2-[4-[[ethyl-[2-(methylamino)ethyl]amino]methyl]-3-methylphenyl]-1-[7-(4-hydroxyphenyl)-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-9-yl]ethanone (PubChem CID 161095100) has the molecular formula C35H39N5O2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[4-[[ethyl-[2-(methylamino)ethyl]amino]methyl]-3-methylphenyl]-1-[7-(4-hydroxyphenyl)-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-9-yl]ethanone.
| Compound Name | 2-[4-[[ethyl-[2-(methylamino)ethyl]amino]methyl]-3-methylphenyl]-1-[7-(4-hydroxyphenyl)-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-9-yl]ethanone |
|---|---|
| PubChem CID | 161095100 |
| Molecular Formula | C35H39N5O2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 2-[4-[[ethyl-[2-(methylamino)ethyl]amino]methyl]-3-methylphenyl]-1-[7-(4-hydroxyphenyl)-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-9-yl]ethanone |
| SMILES | CCN(CCNC)Cc1ccc(CC(=O)C2CCc3c(c(-c4ccc(O)cc4)nc4ccc5[nH]ncc5c34)C2)cc1C |
| InChI | InChI=1S/C35H39N5O2/c1-4-40(16-15-36-3)21-26-6-5-23(17-22(26)2)18-33(42)25-9-12-28-29(19-25)35(24-7-10-27(41)11-8-24)38-32-14-13-31-30(34(28)32)20-37-39-31/h5-8,10-11,13-14,17,20,25,36,41H,4,9,12,15-16,18-19,21H2,1-3H3,(H,37,39) |
| InChIKey | JDOCDLLTOAWUDY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |