C28H31N5O2 — CID 175963820
N-(3-morpholin-4-ylpropyl)-4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)benzamide (PubChem CID 175963820) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)benzamide |
|---|---|
| PubChem CID | 175963820 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(-c2nc3ccc4[nH]ncc4c3c3c2CCCC3)cc1 |
| InChI | InChI=1S/C28H31N5O2/c34-28(29-12-3-13-33-14-16-35-17-15-33)20-8-6-19(7-9-20)27-22-5-2-1-4-21(22)26-23-18-30-32-24(23)10-11-25(26)31-27/h6-11,18H,1-5,12-17H2,(H,29,34)(H,30,32) |
| InChIKey | YPXNLAFBRWKHPG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|