C25H24FNO6 — CID 161095481
4-[5-fluoro-1-(3-hydroxypropyl)indol-3-yl]-5-(3,4,5-trimethoxyphenyl)cyclopent-4-ene-1,3-dione (PubChem CID 161095481) has the molecular formula C25H24FNO6 and a molecular weight of 453.47 g/mol. Its IUPAC name is 4-[5-fluoro-1-(3-hydroxypropyl)indol-3-yl]-5-(3,4,5-trimethoxyphenyl)cyclopent-4-ene-1,3-dione.
| Compound Name | 4-[5-fluoro-1-(3-hydroxypropyl)indol-3-yl]-5-(3,4,5-trimethoxyphenyl)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 161095481 |
| Molecular Formula | C25H24FNO6 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-[5-fluoro-1-(3-hydroxypropyl)indol-3-yl]-5-(3,4,5-trimethoxyphenyl)cyclopent-4-ene-1,3-dione |
| SMILES | COc1cc(C2=C(c3cn(CCCO)c4ccc(F)cc34)C(=O)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H24FNO6/c1-31-21-9-14(10-22(32-2)25(21)33-3)23-19(29)12-20(30)24(23)17-13-27(7-4-8-28)18-6-5-15(26)11-16(17)18/h5-6,9-11,13,28H,4,7-8,12H2,1-3H3 |
| InChIKey | UHSSWACSHOWOMB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|