C13H8FN5 — CID 161095988
2-(5-fluoro-3-pyridinyl)-4-pyridin-2-yl-1,3,5-triazine (PubChem CID 161095988) has the molecular formula C13H8FN5 and a molecular weight of 253.24 g/mol. Its IUPAC name is 2-(5-fluoro-3-pyridinyl)-4-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-(5-fluoro-3-pyridinyl)-4-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 161095988 |
| Molecular Formula | C13H8FN5 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-(5-fluoro-3-pyridinyl)-4-pyridin-2-yl-1,3,5-triazine |
| SMILES | Fc1cncc(-c2ncnc(-c3ccccn3)n2)c1 |
| InChI | InChI=1S/C13H8FN5/c14-10-5-9(6-15-7-10)12-17-8-18-13(19-12)11-3-1-2-4-16-11/h1-8H |
| InChIKey | UHULOOKDYKRDDC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |