C54H42Cl2F10N2O10 — CID 161097980
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(3,3-difluorocyclobutyl)-2-oxobutyl]benzoic acid (PubChem CID 161097980) has the molecular formula C54H42Cl2F10N2O10 and a molecular weight of 1139.82 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(3,3-difluorocyclobutyl)-2-oxobutyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(3,3-difluorocyclobutyl)-2-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 161097980 |
| Molecular Formula | C54H42Cl2F10N2O10 |
| Molecular Weight | 1139.82 g/mol |
| Exact Mass | 1138.21 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(3,3-difluorocyclobutyl)-2-oxobutyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)C(CC2CC(F)(F)C2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1.O=C(O)c1ccc(CC(=O)C(CC2CC(F)(F)C2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/2C27H21ClF5NO5/c2*28-19-6-8-22(39-26(30)31)23(24(19)29)17-5-7-20(34(38)13-17)18(9-15-11-27(32,33)12-15)21(35)10-14-1-3-16(4-2-14)25(36)37/h2*1-8,13,15,18,26H,9-12H2,(H,36,37) |
| InChIKey | UIAVHYQTIXWDQA-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1139.82 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|