About 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one
1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one (PubChem CID 161098405) has the molecular formula C25H25NO4
and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one |
| PubChem CID | 161098405 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one |
| SMILES | CC1=Cc2ccccc2CC1=O.Cc1cc2ccccc2n(CC2OCCO2)c1=O |
| InChI | InChI=1S/C14H15NO3.C11H10O/c1-10-8-11-4-2-3-5-12(11)15(14(10)16)9-13-17-6-7-18-13;1-8-6-9-4-2-3-5-10(9)7-11(8)12/h2-5,8,13H,6-7,9H2,1H3;2-6H,7H2,1H3 |
| InChIKey | UICJVAIDQXQQNK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one?
The IUPAC name of 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one (CID 161098405) is 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one.
What is the SMILES notation for 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one?
The canonical SMILES for 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one is CC1=Cc2ccccc2CC1=O.Cc1cc2ccccc2n(CC2OCCO2)c1=O.
What is the InChIKey of 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one?
The InChIKey is UICJVAIDQXQQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3.C11H10O/c1-10-8-11-4-2-3-5-12(11)15(14(10)16)9-13-17-6-7-18-13;1-8-6-9-4-2-3-5-10(9)7-11(8)12/h2-5,8,13H,6-7,9H2,1H3;2-6H,7H2,1H3.
What are the key properties of 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one?
1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one has a molecular weight of 403.48 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dioxolan-2-ylmethyl)-3-methylquinolin-2-one;3-methyl-1H-naphthalen-2-one is sourced from PubChem (CID 161098405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).