About 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide
4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide (PubChem CID 161099049) has the molecular formula C17H13Cl2I2N3O2S
and a molecular weight of 648.09 g/mol. Its IUPAC name is 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide |
| PubChem CID | 161099049 |
| Molecular Formula | C17H13Cl2I2N3O2S |
| Molecular Weight | 648.09 g/mol |
| Exact Mass | 646.82 |
| IUPAC Name | 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide |
| SMILES | Nc1ccc(Cl)cc1I.O=S(=O)(Nc1ccc(Cl)cc1I)c1ccccn1 |
| InChI | InChI=1S/C11H8ClIN2O2S.C6H5ClIN/c12-8-4-5-10(9(13)7-8)15-18(16,17)11-3-1-2-6-14-11;7-4-1-2-6(9)5(8)3-4/h1-7,15H;1-3H,9H2 |
| InChIKey | UIELBYLPKMLRAK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.09 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide?
The IUPAC name of 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide (CID 161099049) is 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide.
What is the SMILES notation for 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide?
The canonical SMILES for 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide is Nc1ccc(Cl)cc1I.O=S(=O)(Nc1ccc(Cl)cc1I)c1ccccn1.
What is the InChIKey of 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide?
The InChIKey is UIELBYLPKMLRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClIN2O2S.C6H5ClIN/c12-8-4-5-10(9(13)7-8)15-18(16,17)11-3-1-2-6-14-11;7-4-1-2-6(9)5(8)3-4/h1-7,15H;1-3H,9H2.
What are the key properties of 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide?
4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide has a molecular weight of 648.09 g/mol, XLogP of 5.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-iodoaniline;N-(4-chloro-2-iodophenyl)pyridine-2-sulfonamide is sourced from PubChem (CID 161099049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).