C32H35Cl3I2N2O4S2 — CID 159766624
4-tert-butylbenzenesulfonyl chloride;4-tert-butyl-N-(4-chloro-2-iodophenyl)benzenesulfonamide;4-chloro-2-iodoaniline (PubChem CID 159766624) has the molecular formula C32H35Cl3I2N2O4S2 and a molecular weight of 935.94 g/mol. Its IUPAC name is 4-tert-butylbenzenesulfonyl chloride;4-tert-butyl-N-(4-chloro-2-iodophenyl)benzenesulfonamide;4-chloro-2-iodoaniline.
| Compound Name | 4-tert-butylbenzenesulfonyl chloride;4-tert-butyl-N-(4-chloro-2-iodophenyl)benzenesulfonamide;4-chloro-2-iodoaniline |
|---|---|
| PubChem CID | 159766624 |
| Molecular Formula | C32H35Cl3I2N2O4S2 |
| Molecular Weight | 935.94 g/mol |
| Exact Mass | 933.92 |
| IUPAC Name | 4-tert-butylbenzenesulfonyl chloride;4-tert-butyl-N-(4-chloro-2-iodophenyl)benzenesulfonamide;4-chloro-2-iodoaniline |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Cl)cc1.CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2I)cc1.Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C16H17ClINO2S.C10H13ClO2S.C6H5ClIN/c1-16(2,3)11-4-7-13(8-5-11)22(20,21)19-15-9-6-12(17)10-14(15)18;1-10(2,3)8-4-6-9(7-5-8)14(11,12)13;7-4-1-2-6(9)5(8)3-4/h4-10,19H,1-3H3;4-7H,1-3H3;1-3H,9H2 |
| InChIKey | NFOWDWJPHNXRJY-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.94 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|