C21H22ClN2O4S2+ — CID 143141230
4-tert-butyl-N-(4-chloro-2-pyridin-1-ium-4-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 143141230) has the molecular formula C21H22ClN2O4S2+ and a molecular weight of 466.00 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-chloro-2-pyridin-1-ium-4-ylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(4-chloro-2-pyridin-1-ium-4-ylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143141230 |
| Molecular Formula | C21H22ClN2O4S2+ |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-tert-butyl-N-(4-chloro-2-pyridin-1-ium-4-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2S(=O)(=O)c2cc[nH+]cc2)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S2/c1-21(2,3)15-4-7-18(8-5-15)30(27,28)24-19-9-6-16(22)14-20(19)29(25,26)17-10-12-23-13-11-17/h4-14,24H,1-3H3/p+1 |
| InChIKey | UOAPKZZQUQWXFI-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |