About magnesium;iron(2+);borate
magnesium;iron(2+);borate (PubChem CID 161102950) has the molecular formula BFeMgO3+
and a molecular weight of 138.96 g/mol. Its IUPAC name is magnesium;iron(2+);borate.
Molecular Properties
| Compound Name | magnesium;iron(2+);borate |
| PubChem CID | 161102950 |
| Molecular Formula | BFeMgO3+ |
| Molecular Weight | 138.96 g/mol |
| Exact Mass | 138.91 |
| IUPAC Name | magnesium;iron(2+);borate |
| SMILES | [Fe+2].[Mg+2].[O-]B([O-])[O-] |
| InChI | InChI=1S/BO3.Fe.Mg/c2-1(3)4;;/q-3;2*+2 |
| InChIKey | UIRANVUIOSZGNK-UHFFFAOYSA-N |
| XLogP | -4.33 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.96 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;iron(2+);borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;iron(2+);borate?
The IUPAC name of magnesium;iron(2+);borate (CID 161102950) is magnesium;iron(2+);borate.
What is the SMILES notation for magnesium;iron(2+);borate?
The canonical SMILES for magnesium;iron(2+);borate is [Fe+2].[Mg+2].[O-]B([O-])[O-].
What is the InChIKey of magnesium;iron(2+);borate?
The InChIKey is UIRANVUIOSZGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/BO3.Fe.Mg/c2-1(3)4;;/q-3;2*+2.
What are the key properties of magnesium;iron(2+);borate?
magnesium;iron(2+);borate has a molecular weight of 138.96 g/mol, XLogP of -4.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;iron(2+);borate is sourced from PubChem (CID 161102950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).