C27H18O4 — CID 161104453
3,5-bis(4-hydroxyphenyl)-2-phenylchromen-4-one (PubChem CID 161104453) has the molecular formula C27H18O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3,5-bis(4-hydroxyphenyl)-2-phenylchromen-4-one.
| Compound Name | 3,5-bis(4-hydroxyphenyl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 161104453 |
| Molecular Formula | C27H18O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3,5-bis(4-hydroxyphenyl)-2-phenylchromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)c(-c2ccccc2)oc2cccc(-c3ccc(O)cc3)c12 |
| InChI | InChI=1S/C27H18O4/c28-20-13-9-17(10-14-20)22-7-4-8-23-25(22)26(30)24(18-11-15-21(29)16-12-18)27(31-23)19-5-2-1-3-6-19/h1-16,28-29H |
| InChIKey | UIWAMFULABSPQX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |