C16H32F2OSSi — CID 161112104
tert-butyl-[(1S)-1-(4,4-difluorocyclohexyl)but-3-enoxy]-dimethylsilane;sulfane (PubChem CID 161112104) has the molecular formula C16H32F2OSSi and a molecular weight of 338.58 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-(4,4-difluorocyclohexyl)but-3-enoxy]-dimethylsilane;sulfane.
| Compound Name | tert-butyl-[(1S)-1-(4,4-difluorocyclohexyl)but-3-enoxy]-dimethylsilane;sulfane |
|---|---|
| PubChem CID | 161112104 |
| Molecular Formula | C16H32F2OSSi |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl-[(1S)-1-(4,4-difluorocyclohexyl)but-3-enoxy]-dimethylsilane;sulfane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C1CCC(F)(F)CC1.S |
| InChI | InChI=1S/C16H30F2OSi.H2S/c1-7-8-14(19-20(5,6)15(2,3)4)13-9-11-16(17,18)12-10-13;/h7,13-14H,1,8-12H2,2-6H3;1H2/t14-;/m0./s1 |
| InChIKey | UJVDGNJWUBZXHN-UQKRIMTDSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|