C18H35FOSi — CID 10495501
[(1S)-1-[(1R)-1-cyclohexylbut-3-enoxy]hexyl]-fluoro-dimethylsilane (PubChem CID 10495501) has the molecular formula C18H35FOSi and a molecular weight of 314.56 g/mol. Its IUPAC name is [(1S)-1-[(1R)-1-cyclohexylbut-3-enoxy]hexyl]-fluoro-dimethylsilane.
| Compound Name | [(1S)-1-[(1R)-1-cyclohexylbut-3-enoxy]hexyl]-fluoro-dimethylsilane |
|---|---|
| PubChem CID | 10495501 |
| Molecular Formula | C18H35FOSi |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | [(1S)-1-[(1R)-1-cyclohexylbut-3-enoxy]hexyl]-fluoro-dimethylsilane |
| SMILES | C=CC[C@@H](O[C@H](CCCCC)[Si](C)(C)F)C1CCCCC1 |
| InChI | InChI=1S/C18H35FOSi/c1-5-7-9-15-18(21(3,4)19)20-17(12-6-2)16-13-10-8-11-14-16/h6,16-18H,2,5,7-15H2,1,3-4H3/t17-,18+/m1/s1 |
| InChIKey | NOLYTBQRPWIIFS-MSOLQXFVSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|