C13H24OSi — CID 11085456
[(E)-2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane (PubChem CID 11085456) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is [(E)-2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane.
| Compound Name | [(E)-2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11085456 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(E)-2-[(2S,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/[C@@H]1O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H24OSi/c1-15(2,3)10-9-12-13(14-12)11-7-5-4-6-8-11/h9-13H,4-8H2,1-3H3/b10-9+/t12-,13+/m0/s1 |
| InChIKey | KNOIGQZJDRWKHZ-CCJARXIYSA-N |
| XLogP | 3.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|