About [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane
[(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane (PubChem CID 11831083) has the molecular formula C13H24OSi
and a molecular weight of 224.42 g/mol. Its IUPAC name is [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane |
| PubChem CID | 11831083 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/[C@H]1O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H24OSi/c1-15(2,3)10-9-12-13(14-12)11-7-5-4-6-8-11/h9-13H,4-8H2,1-3H3/b10-9+/t12-,13-/m1/s1 |
| InChIKey | KNOIGQZJDRWKHZ-WGVUZWOWSA-N |
| XLogP | 3.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane?
The IUPAC name of [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane (CID 11831083) is [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane.
What is the SMILES notation for [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane?
The canonical SMILES for [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane is C[Si](C)(C)/C=C/[C@H]1O[C@@H]1C1CCCCC1.
What is the InChIKey of [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane?
The InChIKey is KNOIGQZJDRWKHZ-WGVUZWOWSA-N. The full InChI is InChI=1S/C13H24OSi/c1-15(2,3)10-9-12-13(14-12)11-7-5-4-6-8-11/h9-13H,4-8H2,1-3H3/b10-9+/t12-,13-/m1/s1.
What are the key properties of [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane?
[(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane has a molecular weight of 224.42 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[(2R,3R)-3-cyclohexyloxiran-2-yl]ethenyl]-trimethylsilane is sourced from PubChem (CID 11831083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).