About 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide
2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide (PubChem CID 161112605) has the molecular formula C22H18O10S2
and a molecular weight of 506.51 g/mol. Its IUPAC name is 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide.
Molecular Properties
| Compound Name | 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide |
| PubChem CID | 161112605 |
| Molecular Formula | C22H18O10S2 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccc(-c3ccc(C)cc3S(=O)(=O)O)cc2)cc1.O=S(=O)=O |
| InChI | InChI=1S/C22H18O7S.O3S/c1-14-3-12-19(20(13-14)30(25,26)27)15-8-10-18(11-9-15)29-22(24)17-6-4-16(5-7-17)21(23)28-2;1-4(2)3/h3-13H,1-2H3,(H,25,26,27); |
| InChIKey | UJWWCVZIMIWQPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide?
The IUPAC name of 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide (CID 161112605) is 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide.
What is the SMILES notation for 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide?
The canonical SMILES for 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide is COC(=O)c1ccc(C(=O)Oc2ccc(-c3ccc(C)cc3S(=O)(=O)O)cc2)cc1.O=S(=O)=O.
What is the InChIKey of 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide?
The InChIKey is UJWWCVZIMIWQPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O7S.O3S/c1-14-3-12-19(20(13-14)30(25,26)27)15-8-10-18(11-9-15)29-22(24)17-6-4-16(5-7-17)21(23)28-2;1-4(2)3/h3-13H,1-2H3,(H,25,26,27);.
What are the key properties of 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide?
2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide has a molecular weight of 506.51 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methoxycarbonylbenzoyl)oxyphenyl]-5-methylbenzenesulfonic acid;sulfur trioxide is sourced from PubChem (CID 161112605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).