C17H36N4O4S — CID 161118551
2,2-dimethylpropane;2-methyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propane-2-sulfonamide (PubChem CID 161118551) has the molecular formula C17H36N4O4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-methyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propane-2-sulfonamide.
| Compound Name | 2,2-dimethylpropane;2-methyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 161118551 |
| Molecular Formula | C17H36N4O4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2,2-dimethylpropane;2-methyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)C.CC(C)(C)S(=O)(=O)NCCOCCOCCn1ccnn1 |
| InChI | InChI=1S/C12H24N4O4S.C5H12/c1-12(2,3)21(17,18)14-5-8-19-10-11-20-9-7-16-6-4-13-15-16;1-5(2,3)4/h4,6,14H,5,7-11H2,1-3H3;1-4H3 |
| InChIKey | UKQIRKZKQPUJDW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|