C10H20N4O4S — CID 163856234
N-[2-[2-[2-(triazol-1-yl)ethoxy]propoxy]ethyl]methanesulfonamide (PubChem CID 163856234) has the molecular formula C10H20N4O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[2-[2-[2-(triazol-1-yl)ethoxy]propoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[2-(triazol-1-yl)ethoxy]propoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 163856234 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[2-[2-[2-(triazol-1-yl)ethoxy]propoxy]ethyl]methanesulfonamide |
| SMILES | CC(COCCNS(C)(=O)=O)OCCn1ccnn1 |
| InChI | InChI=1S/C10H20N4O4S/c1-10(9-17-7-4-12-19(2,15)16)18-8-6-14-5-3-11-13-14/h3,5,10,12H,4,6-9H2,1-2H3 |
| InChIKey | OYNUMYPJFKYXRF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|