About 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform
1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform (PubChem CID 161122342) has the molecular formula C13H27F3NO+
and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform.
Molecular Properties
| Compound Name | 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform |
| PubChem CID | 161122342 |
| Molecular Formula | C13H27F3NO+ |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform |
| SMILES | CCCC[N+]1(COC(C)C)CCCC1.FC(F)F |
| InChI | InChI=1S/C12H26NO.CHF3/c1-4-5-8-13(9-6-7-10-13)11-14-12(2)3;2-1(3)4/h12H,4-11H2,1-3H3;1H/q+1; |
| InChIKey | ULCOPUVEEPDTKJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform?
The IUPAC name of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform (CID 161122342) is 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform.
What is the SMILES notation for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform?
The canonical SMILES for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform is CCCC[N+]1(COC(C)C)CCCC1.FC(F)F.
What is the InChIKey of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform?
The InChIKey is ULCOPUVEEPDTKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26NO.CHF3/c1-4-5-8-13(9-6-7-10-13)11-14-12(2)3;2-1(3)4/h12H,4-11H2,1-3H3;1H/q+1;.
What are the key properties of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform?
1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform has a molecular weight of 270.36 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;fluoroform is sourced from PubChem (CID 161122342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).