C34H36F6N2O4 — CID 161122700
[(2R,3R,6R)-6-[2-[2-[(3S)-3-amino-4,4-bis(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]-2-methylmorpholin-3-yl]methyl 4,4,4-trifluorobutanoate (PubChem CID 161122700) has the molecular formula C34H36F6N2O4 and a molecular weight of 650.66 g/mol. Its IUPAC name is [(2R,3R,6R)-6-[2-[2-[(3S)-3-amino-4,4-bis(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]-2-methylmorpholin-3-yl]methyl 4,4,4-trifluorobutanoate.
| Compound Name | [(2R,3R,6R)-6-[2-[2-[(3S)-3-amino-4,4-bis(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]-2-methylmorpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 161122700 |
| Molecular Formula | C34H36F6N2O4 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | [(2R,3R,6R)-6-[2-[2-[(3S)-3-amino-4,4-bis(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]-2-methylmorpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
| SMILES | C[C@H]1O[C@H](CCc2c(F)cccc2CC(=O)[C@@H](N)C(c2ccc(F)cc2)c2ccc(F)cc2)CN[C@@H]1COC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C34H36F6N2O4/c1-20-29(19-45-31(44)15-16-34(38,39)40)42-18-26(46-20)13-14-27-23(3-2-4-28(27)37)17-30(43)33(41)32(21-5-9-24(35)10-6-21)22-7-11-25(36)12-8-22/h2-12,20,26,29,32-33,42H,13-19,41H2,1H3/t20-,26-,29-,33-/m1/s1 |
| InChIKey | ULDSTTZMOYGZQP-IWZWHNAWSA-N |
| XLogP | 5.94 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |