C31H33F6N5O4 — CID 122638898
[(2S,3R,6R)-6-[2-[3-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-5-fluoro-4-pyridinyl]ethyl]-2-methylmorpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 122638898) has the molecular formula C31H33F6N5O4 and a molecular weight of 653.62 g/mol. Its IUPAC name is [(2S,3R,6R)-6-[2-[3-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-5-fluoro-4-pyridinyl]ethyl]-2-methylmorpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(2S,3R,6R)-6-[2-[3-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-5-fluoro-4-pyridinyl]ethyl]-2-methylmorpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 122638898 |
| Molecular Formula | C31H33F6N5O4 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | [(2S,3R,6R)-6-[2-[3-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-5-fluoro-4-pyridinyl]ethyl]-2-methylmorpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | C[C@@H]1O[C@H](CCc2c(F)cncc2N[C@H](C(N)=O)C(c2ccc(F)cc2)c2ccc(F)cc2)CN[C@@H]1COC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C31H33F6N5O4/c1-17-26(15-45-30(44)41-16-31(35,36)37)40-12-22(46-17)10-11-23-24(34)13-39-14-25(23)42-28(29(38)43)27(18-2-6-20(32)7-3-18)19-4-8-21(33)9-5-19/h2-9,13-14,17,22,26-28,40,42H,10-12,15-16H2,1H3,(H2,38,43)(H,41,44)/t17-,22+,26+,28-/m0/s1 |
| InChIKey | LGDJGUNZEKEVRZ-NHGAYJRLSA-N |
| XLogP | 4.56 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |