C30H31F6N5O4 — CID 130291253
[(2S,6R)-6-[2-[3-[[2-amino-3,3-bis(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-2-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 130291253) has the molecular formula C30H31F6N5O4 and a molecular weight of 639.60 g/mol. Its IUPAC name is [(2S,6R)-6-[2-[3-[[2-amino-3,3-bis(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-2-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(2S,6R)-6-[2-[3-[[2-amino-3,3-bis(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-2-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 130291253 |
| Molecular Formula | C30H31F6N5O4 |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | [(2S,6R)-6-[2-[3-[[2-amino-3,3-bis(4-fluorophenyl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-2-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | NC(C(=O)Nc1cncc(F)c1CC[C@@H]1CNC[C@@H](COC(=O)NCC(F)(F)F)O1)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H31F6N5O4/c31-19-5-1-17(2-6-19)26(18-3-7-20(32)8-4-18)27(37)28(42)41-25-14-39-13-24(33)23(25)10-9-21-11-38-12-22(45-21)15-44-29(43)40-16-30(34,35)36/h1-8,13-14,21-22,26-27,38H,9-12,15-16,37H2,(H,40,43)(H,41,42)/t21-,22+,27?/m1/s1 |
| InChIKey | WWFVPJBZKNHVHN-OCTGXNKJSA-N |
| XLogP | 4.17 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |