C36H40N2O5 — CID 161124345
4-(3H-inden-1-yl)butanoic acid;1-[3-(1H-indol-3-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 161124345) has the molecular formula C36H40N2O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is 4-(3H-inden-1-yl)butanoic acid;1-[3-(1H-indol-3-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 4-(3H-inden-1-yl)butanoic acid;1-[3-(1H-indol-3-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 161124345 |
| Molecular Formula | C36H40N2O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 4-(3H-inden-1-yl)butanoic acid;1-[3-(1H-indol-3-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)C(CCCc1c[nH]c3ccccc13)N(C=O)CC2.O=C(O)CCCC1=CCc2ccccc21 |
| InChI | InChI=1S/C23H26N2O3.C13H14O2/c1-27-22-12-16-10-11-25(15-26)21(19(16)13-23(22)28-2)9-5-6-17-14-24-20-8-4-3-7-18(17)20;14-13(15)7-3-5-11-9-8-10-4-1-2-6-12(10)11/h3-4,7-8,12-15,21,24H,5-6,9-11H2,1-2H3;1-2,4,6,9H,3,5,7-8H2,(H,14,15) |
| InChIKey | ULJAOLQRQVBCGI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|