C20H20FNO3 — CID 161125330
(2R)-2-benzyl-4-[(2S)-1-(4-fluorophenyl)azetidin-2-yl]-4-oxobutanoic acid (PubChem CID 161125330) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is (2R)-2-benzyl-4-[(2S)-1-(4-fluorophenyl)azetidin-2-yl]-4-oxobutanoic acid.
| Compound Name | (2R)-2-benzyl-4-[(2S)-1-(4-fluorophenyl)azetidin-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 161125330 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-2-benzyl-4-[(2S)-1-(4-fluorophenyl)azetidin-2-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)[C@@H](CC(=O)[C@@H]1CCN1c1ccc(F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H20FNO3/c21-16-6-8-17(9-7-16)22-11-10-18(22)19(23)13-15(20(24)25)12-14-4-2-1-3-5-14/h1-9,15,18H,10-13H2,(H,24,25)/t15-,18+/m1/s1 |
| InChIKey | KJEMESYTAUNQFO-QAPCUYQASA-N |
| XLogP | 3.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |