C55H65N2O5+ — CID 161128344
1-benzyl-4-[(5,6-dimethoxy-1H-inden-2-yl)methyl]piperidine;2-[(1,1-dibenzylpiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 161128344) has the molecular formula C55H65N2O5+ and a molecular weight of 834.13 g/mol. Its IUPAC name is 1-benzyl-4-[(5,6-dimethoxy-1H-inden-2-yl)methyl]piperidine;2-[(1,1-dibenzylpiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 1-benzyl-4-[(5,6-dimethoxy-1H-inden-2-yl)methyl]piperidine;2-[(1,1-dibenzylpiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 161128344 |
| Molecular Formula | C55H65N2O5+ |
| Molecular Weight | 834.13 g/mol |
| Exact Mass | 833.49 |
| IUPAC Name | 1-benzyl-4-[(5,6-dimethoxy-1H-inden-2-yl)methyl]piperidine;2-[(1,1-dibenzylpiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CC[N+](Cc3ccccc3)(Cc3ccccc3)CC1)C2.COc1cc2c(cc1OC)CC(CC1CCN(Cc3ccccc3)CC1)=C2 |
| InChI | InChI=1S/C31H36NO3.C24H29NO2/c1-34-29-19-26-18-27(31(33)28(26)20-30(29)35-2)17-23-13-15-32(16-14-23,21-24-9-5-3-6-10-24)22-25-11-7-4-8-12-25;1-26-23-15-21-13-20(14-22(21)16-24(23)27-2)12-18-8-10-25(11-9-18)17-19-6-4-3-5-7-19/h3-12,19-20,23,27H,13-18,21-22H2,1-2H3;3-7,13,15-16,18H,8-12,14,17H2,1-2H3/q+1; |
| InChIKey | WLIBBZOPTDRMBK-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.13 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|