C18H28F6N2O3 — CID 161138267
N-methyl-3-(phenylmethoxymethoxy)-N-(trifluoromethyl)propan-1-amine;3-[methyl(trifluoromethyl)amino]propan-1-ol (PubChem CID 161138267) has the molecular formula C18H28F6N2O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is N-methyl-3-(phenylmethoxymethoxy)-N-(trifluoromethyl)propan-1-amine;3-[methyl(trifluoromethyl)amino]propan-1-ol.
| Compound Name | N-methyl-3-(phenylmethoxymethoxy)-N-(trifluoromethyl)propan-1-amine;3-[methyl(trifluoromethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 161138267 |
| Molecular Formula | C18H28F6N2O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-methyl-3-(phenylmethoxymethoxy)-N-(trifluoromethyl)propan-1-amine;3-[methyl(trifluoromethyl)amino]propan-1-ol |
| SMILES | CN(CCCO)C(F)(F)F.CN(CCCOCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO2.C5H10F3NO/c1-17(13(14,15)16)8-5-9-18-11-19-10-12-6-3-2-4-7-12;1-9(3-2-4-10)5(6,7)8/h2-4,6-7H,5,8-11H2,1H3;10H,2-4H2,1H3 |
| InChIKey | UNBXKTXOSSINMH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|