About 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium
4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium (PubChem CID 161145857) has the molecular formula C31H30NO2U-
and a molecular weight of 686.62 g/mol. Its IUPAC name is 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium.
Molecular Properties
| Compound Name | 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium |
| PubChem CID | 161145857 |
| Molecular Formula | C31H30NO2U- |
| Molecular Weight | 686.62 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium |
| SMILES | CCOC(=O)/C=C/c1ccc(Cc2cc[c-]cc2)cc1.Nc1ccc(Cc2ccccc2)cc1.[U] |
| InChI | InChI=1S/C18H17O2.C13H13N.U/c1-2-20-18(19)13-12-15-8-10-17(11-9-15)14-16-6-4-3-5-7-16;14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11;/h4-13H,2,14H2,1H3;1-9H,10,14H2;/q-1;;/b13-12+;; |
| InChIKey | PLJYKBLUHDBIOI-HPAIREQNSA-N |
| XLogP | 6.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 686.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium?
The IUPAC name of 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium (CID 161145857) is 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium.
What is the SMILES notation for 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium?
The canonical SMILES for 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium is CCOC(=O)/C=C/c1ccc(Cc2cc[c-]cc2)cc1.Nc1ccc(Cc2ccccc2)cc1.[U].
What is the InChIKey of 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium?
The InChIKey is PLJYKBLUHDBIOI-HPAIREQNSA-N. The full InChI is InChI=1S/C18H17O2.C13H13N.U/c1-2-20-18(19)13-12-15-8-10-17(11-9-15)14-16-6-4-3-5-7-16;14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11;/h4-13H,2,14H2,1H3;1-9H,10,14H2;/q-1;;/b13-12+;;.
What are the key properties of 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium?
4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium has a molecular weight of 686.62 g/mol, XLogP of 6.51, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylaniline;ethyl (E)-3-[4-(phenylmethyl)phenyl]prop-2-enoate;uranium is sourced from PubChem (CID 161145857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).