C18H14N2O4S — CID 161151792
2-(furan-2-yl)-1,3-oxazole;1,3-oxazole;2-thiophen-2-ylfuran (PubChem CID 161151792) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-oxazole;1,3-oxazole;2-thiophen-2-ylfuran.
| Compound Name | 2-(furan-2-yl)-1,3-oxazole;1,3-oxazole;2-thiophen-2-ylfuran |
|---|---|
| PubChem CID | 161151792 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-(furan-2-yl)-1,3-oxazole;1,3-oxazole;2-thiophen-2-ylfuran |
| SMILES | c1coc(-c2cccs2)c1.c1coc(-c2ncco2)c1.c1cocn1 |
| InChI | InChI=1S/C8H6OS.C7H5NO2.C3H3NO/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-6(9-4-1)7-8-3-5-10-7;1-2-5-3-4-1/h1-6H;1-5H;1-3H |
| InChIKey | UOTVYDXLIIURJI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |