C26H27N3O3S — CID 161160157
1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-ylmethyl 2-[4-ethyl-2-(2-methoxyphenyl)-1,3-thiazol-5-yl]acetate (PubChem CID 161160157) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-ylmethyl 2-[4-ethyl-2-(2-methoxyphenyl)-1,3-thiazol-5-yl]acetate.
| Compound Name | 1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-ylmethyl 2-[4-ethyl-2-(2-methoxyphenyl)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 161160157 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-ylmethyl 2-[4-ethyl-2-(2-methoxyphenyl)-1,3-thiazol-5-yl]acetate |
| SMILES | CCc1nc(-c2ccccc2OC)sc1CC(=O)OCc1ccc2c(c1)nc1n2CCCC1 |
| InChI | InChI=1S/C26H27N3O3S/c1-3-19-23(33-26(28-19)18-8-4-5-9-22(18)31-2)15-25(30)32-16-17-11-12-21-20(14-17)27-24-10-6-7-13-29(21)24/h4-5,8-9,11-12,14H,3,6-7,10,13,15-16H2,1-2H3 |
| InChIKey | UPUWMISQKNUYHX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |