C24H23ClN4O2S — CID 89459678
[2-(4-chloro-2-methylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)carbamate (PubChem CID 89459678) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is [2-(4-chloro-2-methylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)carbamate.
| Compound Name | [2-(4-chloro-2-methylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)carbamate |
|---|---|
| PubChem CID | 89459678 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | [2-(4-chloro-2-methylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)carbamate |
| SMILES | Cc1cc(Cl)ccc1-c1nc(C)c(COC(=O)Nc2ccc3c(c2)nc2n3CCCC2)s1 |
| InChI | InChI=1S/C24H23ClN4O2S/c1-14-11-16(25)6-8-18(14)23-26-15(2)21(32-23)13-31-24(30)27-17-7-9-20-19(12-17)28-22-5-3-4-10-29(20)22/h6-9,11-12H,3-5,10,13H2,1-2H3,(H,27,30) |
| InChIKey | LWFYHTCOEIHBNM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |