About [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate
[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate (PubChem CID 89459688) has the molecular formula C23H24N4O2S
and a molecular weight of 420.54 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate.
Molecular Properties
| Compound Name | [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate |
| PubChem CID | 89459688 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate |
| SMILES | CCn1ncc2cc(NC(=O)OCc3sc(-c4ccc(C)cc4C)nc3C)ccc21 |
| InChI | InChI=1S/C23H24N4O2S/c1-5-27-20-9-7-18(11-17(20)12-24-27)26-23(28)29-13-21-16(4)25-22(30-21)19-8-6-14(2)10-15(19)3/h6-12H,5,13H2,1-4H3,(H,26,28) |
| InChIKey | IVNGWPGHYYUGEY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate?
The IUPAC name of [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate (CID 89459688) is [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate.
What is the SMILES notation for [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate?
The canonical SMILES for [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate is CCn1ncc2cc(NC(=O)OCc3sc(-c4ccc(C)cc4C)nc3C)ccc21.
What is the InChIKey of [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate?
The InChIKey is IVNGWPGHYYUGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2S/c1-5-27-20-9-7-18(11-17(20)12-24-27)26-23(28)29-13-21-16(4)25-22(30-21)19-8-6-14(2)10-15(19)3/h6-12H,5,13H2,1-4H3,(H,26,28).
What are the key properties of [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate?
[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate has a molecular weight of 420.54 g/mol, XLogP of 5.85, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]methyl N-(1-ethylindazol-5-yl)carbamate is sourced from PubChem (CID 89459688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).