About 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate
1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate (PubChem CID 161167614) has the molecular formula C22H32N4O6
and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate |
| PubChem CID | 161167614 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate |
| SMILES | COC(=O)C1=CCN(C(=O)OC(C)(C)C)C=C1.COC(=O)NC(=Cn1ccnc1)C(C)C |
| InChI | InChI=1S/C12H17NO4.C10H15N3O2/c1-12(2,3)17-11(15)13-7-5-9(6-8-13)10(14)16-4;1-8(2)9(12-10(14)15-3)6-13-5-4-11-7-13/h5-7H,8H2,1-4H3;4-8H,1-3H3,(H,12,14) |
| InChIKey | UQTIMGDMFMJZIC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate?
The IUPAC name of 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate (CID 161167614) is 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate.
What is the SMILES notation for 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate?
The canonical SMILES for 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate is COC(=O)C1=CCN(C(=O)OC(C)(C)C)C=C1.COC(=O)NC(=Cn1ccnc1)C(C)C.
What is the InChIKey of 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate?
The InChIKey is UQTIMGDMFMJZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4.C10H15N3O2/c1-12(2,3)17-11(15)13-7-5-9(6-8-13)10(14)16-4;1-8(2)9(12-10(14)15-3)6-13-5-4-11-7-13/h5-7H,8H2,1-4H3;4-8H,1-3H3,(H,12,14).
What are the key properties of 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate?
1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate has a molecular weight of 448.52 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-methyl 2H-pyridine-1,4-dicarboxylate;methyl N-(1-imidazol-1-yl-3-methylbut-1-en-2-yl)carbamate is sourced from PubChem (CID 161167614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).