C12H15N3O2 — CID 67391440
tert-butyl 5H-pyrazolo[3,4-d]azepine-6-carboxylate (PubChem CID 67391440) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is tert-butyl 5H-pyrazolo[3,4-d]azepine-6-carboxylate.
| Compound Name | tert-butyl 5H-pyrazolo[3,4-d]azepine-6-carboxylate |
|---|---|
| PubChem CID | 67391440 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | tert-butyl 5H-pyrazolo[3,4-d]azepine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=NN=CC2=CC1 |
| InChI | InChI=1S/C12H15N3O2/c1-12(2,3)17-11(16)15-6-4-9-8-13-14-10(9)5-7-15/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | RQVHIMVQUHFVMG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |