C17H22N2O5S — CID 86671556
tert-butyl 4-[6-(methylsulfonyloxymethyl)-3-pyridinyl]-2H-pyridine-1-carboxylate (PubChem CID 86671556) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is tert-butyl 4-[6-(methylsulfonyloxymethyl)-3-pyridinyl]-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(methylsulfonyloxymethyl)-3-pyridinyl]-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86671556 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | tert-butyl 4-[6-(methylsulfonyloxymethyl)-3-pyridinyl]-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(c2ccc(COS(C)(=O)=O)nc2)=CC1 |
| InChI | InChI=1S/C17H22N2O5S/c1-17(2,3)24-16(20)19-9-7-13(8-10-19)14-5-6-15(18-11-14)12-23-25(4,21)22/h5-9,11H,10,12H2,1-4H3 |
| InChIKey | ZUFQCHSGCBGYLC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|