C24H22N4O5S — CID 58266606
tert-butyl 4-cyano-12-[4-(methylsulfonyloxymethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate (PubChem CID 58266606) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is tert-butyl 4-cyano-12-[4-(methylsulfonyloxymethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate.
| Compound Name | tert-butyl 4-cyano-12-[4-(methylsulfonyloxymethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 58266606 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | tert-butyl 4-cyano-12-[4-(methylsulfonyloxymethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2cnc(C#N)cc2c2cc(-c3ccc(COS(C)(=O)=O)cc3)cnc21 |
| InChI | InChI=1S/C24H22N4O5S/c1-24(2,3)33-23(29)28-21-13-26-18(11-25)10-19(21)20-9-17(12-27-22(20)28)16-7-5-15(6-8-16)14-32-34(4,30)31/h5-10,12-13H,14H2,1-4H3 |
| InChIKey | GALYNILQEXPZKT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 124.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|