C26H26N6O2 — CID 44545754
tert-butyl 4-[3-(4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl)phenyl]piperazine-1-carboxylate (PubChem CID 44545754) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 44545754 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | tert-butyl 4-[3-(4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(-c3cnc4[nH]c5cnc(C#N)cc5c4c3)c2)CC1 |
| InChI | InChI=1S/C26H26N6O2/c1-26(2,3)34-25(33)32-9-7-31(8-10-32)20-6-4-5-17(11-20)18-12-22-21-13-19(14-27)28-16-23(21)30-24(22)29-15-18/h4-6,11-13,15-16H,7-10H2,1-3H3,(H,29,30) |
| InChIKey | OQPTYTBXBOJQIB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |