C27H37N5O2 — CID 164553944
tert-butyl 4-[5-(3-cyano-1H-indol-6-yl)-2-pyridinyl]piperazine-1-carboxylate;ethane (PubChem CID 164553944) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is tert-butyl 4-[5-(3-cyano-1H-indol-6-yl)-2-pyridinyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[5-(3-cyano-1H-indol-6-yl)-2-pyridinyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 164553944 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | tert-butyl 4-[5-(3-cyano-1H-indol-6-yl)-2-pyridinyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccc4c(C#N)c[nH]c4c3)cn2)CC1 |
| InChI | InChI=1S/C23H25N5O2.2C2H6/c1-23(2,3)30-22(29)28-10-8-27(9-11-28)21-7-5-17(14-26-21)16-4-6-19-18(13-24)15-25-20(19)12-16;2*1-2/h4-7,12,14-15,25H,8-11H2,1-3H3;2*1-2H3 |
| InChIKey | MAABKHHLFUEGQZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |