About 1-(diazomethyl)pyrene
1-(diazomethyl)pyrene (PubChem CID 161167887) has the molecular formula C34H20N4
and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-(diazomethyl)pyrene.
Molecular Properties
| Compound Name | 1-(diazomethyl)pyrene |
| PubChem CID | 161167887 |
| Molecular Formula | C34H20N4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-(diazomethyl)pyrene |
| SMILES | [N-]=[N+]=Cc1ccc2ccc3cccc4ccc1c2c34.[N-]=[N+]=Cc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/2C17H10N2/c2*18-19-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h2*1-10H |
| InChIKey | UQUHUBURLLGKIV-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(diazomethyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diazomethyl)pyrene?
The IUPAC name of 1-(diazomethyl)pyrene (CID 161167887) is 1-(diazomethyl)pyrene.
What is the SMILES notation for 1-(diazomethyl)pyrene?
The canonical SMILES for 1-(diazomethyl)pyrene is [N-]=[N+]=Cc1ccc2ccc3cccc4ccc1c2c34.[N-]=[N+]=Cc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 1-(diazomethyl)pyrene?
The InChIKey is UQUHUBURLLGKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H10N2/c2*18-19-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h2*1-10H.
What are the key properties of 1-(diazomethyl)pyrene?
1-(diazomethyl)pyrene has a molecular weight of 484.56 g/mol, XLogP of 8.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diazomethyl)pyrene is sourced from PubChem (CID 161167887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).