C24H22F2N4 — CID 161170313
1-[6-[6-(2,6-difluorophenyl)-3H-inden-1-yl]pyrazin-2-yl]piperidin-3-amine (PubChem CID 161170313) has the molecular formula C24H22F2N4 and a molecular weight of 404.46 g/mol. Its IUPAC name is 1-[6-[6-(2,6-difluorophenyl)-3H-inden-1-yl]pyrazin-2-yl]piperidin-3-amine.
| Compound Name | 1-[6-[6-(2,6-difluorophenyl)-3H-inden-1-yl]pyrazin-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 161170313 |
| Molecular Formula | C24H22F2N4 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[6-[6-(2,6-difluorophenyl)-3H-inden-1-yl]pyrazin-2-yl]piperidin-3-amine |
| SMILES | NC1CCCN(c2cncc(C3=CCc4ccc(-c5c(F)cccc5F)cc43)n2)C1 |
| InChI | InChI=1S/C24H22F2N4/c25-20-4-1-5-21(26)24(20)16-7-6-15-8-9-18(19(15)11-16)22-12-28-13-23(29-22)30-10-2-3-17(27)14-30/h1,4-7,9,11-13,17H,2-3,8,10,14,27H2 |
| InChIKey | IWXDVKPPRQFIAC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |