C15H9Cl3F6N2O2 — CID 161178204
2,5-dichloro-4-(trifluoromethyl)pyridine;ethyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 161178204) has the molecular formula C15H9Cl3F6N2O2 and a molecular weight of 469.60 g/mol. Its IUPAC name is 2,5-dichloro-4-(trifluoromethyl)pyridine;ethyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | 2,5-dichloro-4-(trifluoromethyl)pyridine;ethyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 161178204 |
| Molecular Formula | C15H9Cl3F6N2O2 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | 2,5-dichloro-4-(trifluoromethyl)pyridine;ethyl 5-chloro-4-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)c(Cl)cn1.FC(F)(F)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C9H7ClF3NO2.C6H2Cl2F3N/c1-2-16-8(15)7-3-5(9(11,12)13)6(10)4-14-7;7-4-2-12-5(8)1-3(4)6(9,10)11/h3-4H,2H2,1H3;1-2H |
| InChIKey | USCDNQZXDOAREZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|