C33H38ClN3O5S2 — CID 161179522
(23R,24E)-10-chloro-29,29-dioxo-23-(1,3-thiazol-2-ylmethoxy)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one (PubChem CID 161179522) has the molecular formula C33H38ClN3O5S2 and a molecular weight of 656.27 g/mol. Its IUPAC name is (23R,24E)-10-chloro-29,29-dioxo-23-(1,3-thiazol-2-ylmethoxy)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one.
| Compound Name | (23R,24E)-10-chloro-29,29-dioxo-23-(1,3-thiazol-2-ylmethoxy)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one |
|---|---|
| PubChem CID | 161179522 |
| Molecular Formula | C33H38ClN3O5S2 |
| Molecular Weight | 656.27 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | (23R,24E)-10-chloro-29,29-dioxo-23-(1,3-thiazol-2-ylmethoxy)-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-31-one |
| SMILES | O=C1NS(=O)(=O)CCC/C=C\[C@@H](OCc2nccs2)C2CCC2CN2CCCCc3cc(Cl)ccc3COc3ccc1cc32 |
| InChI | InChI=1S/C33H38ClN3O5S2/c34-27-11-8-26-21-41-31-13-10-24-19-29(31)37(15-4-3-6-23(26)18-27)20-25-9-12-28(25)30(42-22-32-35-14-16-43-32)7-2-1-5-17-44(39,40)36-33(24)38/h2,7-8,10-11,13-14,16,18-19,25,28,30H,1,3-6,9,12,15,17,20-22H2,(H,36,38)/b7-2-/t25?,28?,30-/m1/s1 |
| InChIKey | BTRYVCGTIHEVCS-BBNLWGRMSA-N |
| XLogP | 6.54 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.27 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|