C32H39ClN2O7S — CID 166673957
3-[[(23R,24E)-10-chloro-29,29,31-trioxo-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-23-yl]oxy]propanoic acid (PubChem CID 166673957) has the molecular formula C32H39ClN2O7S and a molecular weight of 631.19 g/mol. Its IUPAC name is 3-[[(23R,24E)-10-chloro-29,29,31-trioxo-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-23-yl]oxy]propanoic acid.
| Compound Name | 3-[[(23R,24E)-10-chloro-29,29,31-trioxo-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-23-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 166673957 |
| Molecular Formula | C32H39ClN2O7S |
| Molecular Weight | 631.19 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 3-[[(23R,24E)-10-chloro-29,29,31-trioxo-5-oxa-29λ6-thia-17,30-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaen-23-yl]oxy]propanoic acid |
| SMILES | O=C(O)CCO[C@@H]1/C=C\CCCS(=O)(=O)NC(=O)c2ccc3c(c2)N(CCCCc2cc(Cl)ccc2CO3)CC2CCC21 |
| InChI | InChI=1S/C32H39ClN2O7S/c33-26-11-8-25-21-42-30-13-10-23-19-28(30)35(15-4-3-6-22(25)18-26)20-24-9-12-27(24)29(41-16-14-31(36)37)7-2-1-5-17-43(39,40)34-32(23)38/h2,7-8,10-11,13,18-19,24,27,29H,1,3-6,9,12,14-17,20-21H2,(H,34,38)(H,36,37)/b7-2-/t24?,27?,29-/m1/s1 |
| InChIKey | ZCBCYUSXWAQWEW-NQHAALJSSA-N |
| XLogP | 5.36 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.19 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|