C37H53N3O2 — CID 161180871
N-[(7Z,10Z,13Z,16Z,19Z,22Z)-4-oxopentacosa-7,10,13,16,19,22-hexaenyl]-6-(2-pyrrolidin-1-ylethyl)pyridine-3-carboxamide (PubChem CID 161180871) has the molecular formula C37H53N3O2 and a molecular weight of 571.85 g/mol. Its IUPAC name is N-[(7Z,10Z,13Z,16Z,19Z,22Z)-4-oxopentacosa-7,10,13,16,19,22-hexaenyl]-6-(2-pyrrolidin-1-ylethyl)pyridine-3-carboxamide.
| Compound Name | N-[(7Z,10Z,13Z,16Z,19Z,22Z)-4-oxopentacosa-7,10,13,16,19,22-hexaenyl]-6-(2-pyrrolidin-1-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 161180871 |
| Molecular Formula | C37H53N3O2 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.41 |
| IUPAC Name | N-[(7Z,10Z,13Z,16Z,19Z,22Z)-4-oxopentacosa-7,10,13,16,19,22-hexaenyl]-6-(2-pyrrolidin-1-ylethyl)pyridine-3-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CCCNC(=O)c1ccc(CCN2CCCC2)nc1 |
| InChI | InChI=1S/C37H53N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-36(41)25-23-29-38-37(42)34-26-27-35(39-33-34)28-32-40-30-21-22-31-40/h3-4,6-7,9-10,12-13,15-16,18-19,26-27,33H,2,5,8,11,14,17,20-25,28-32H2,1H3,(H,38,42)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | USKYJMWNVQIFIE-KUBAVDMBSA-N |
| XLogP | 8.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|