C11H24P+ — CID 161181340
1,1-di(propan-2-yl)phosphinan-1-ium (PubChem CID 161181340) has the molecular formula C11H24P+ and a molecular weight of 187.29 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)phosphinan-1-ium.
| Compound Name | 1,1-di(propan-2-yl)phosphinan-1-ium |
|---|---|
| PubChem CID | 161181340 |
| Molecular Formula | C11H24P+ |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1,1-di(propan-2-yl)phosphinan-1-ium |
| SMILES | CC(C)[P+]1(C(C)C)CCCCC1 |
| InChI | InChI=1S/C11H24P/c1-10(2)12(11(3)4)8-6-5-7-9-12/h10-11H,5-9H2,1-4H3/q+1 |
| InChIKey | DJNYTTLGRJTJHH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|