C12H26P+ — CID 161181341
1,1-di(propan-2-yl)phosphepan-1-ium (PubChem CID 161181341) has the molecular formula C12H26P+ and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)phosphepan-1-ium.
| Compound Name | 1,1-di(propan-2-yl)phosphepan-1-ium |
|---|---|
| PubChem CID | 161181341 |
| Molecular Formula | C12H26P+ |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1,1-di(propan-2-yl)phosphepan-1-ium |
| SMILES | CC(C)[P+]1(C(C)C)CCCCCC1 |
| InChI | InChI=1S/C12H26P/c1-11(2)13(12(3)4)9-7-5-6-8-10-13/h11-12H,5-10H2,1-4H3/q+1 |
| InChIKey | DEOXOTHTCXPWNZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|