C23H24Br2F4O5 — CID 161185780
tert-butyl 5-bromo-2,3-difluoro-6-hydroxybenzoate;tert-butyl 5-bromo-2,3-difluoro-6-methylbenzoate (PubChem CID 161185780) has the molecular formula C23H24Br2F4O5 and a molecular weight of 616.24 g/mol. Its IUPAC name is tert-butyl 5-bromo-2,3-difluoro-6-hydroxybenzoate;tert-butyl 5-bromo-2,3-difluoro-6-methylbenzoate.
| Compound Name | tert-butyl 5-bromo-2,3-difluoro-6-hydroxybenzoate;tert-butyl 5-bromo-2,3-difluoro-6-methylbenzoate |
|---|---|
| PubChem CID | 161185780 |
| Molecular Formula | C23H24Br2F4O5 |
| Molecular Weight | 616.24 g/mol |
| Exact Mass | 613.99 |
| IUPAC Name | tert-butyl 5-bromo-2,3-difluoro-6-hydroxybenzoate;tert-butyl 5-bromo-2,3-difluoro-6-methylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1c(O)c(Br)cc(F)c1F.Cc1c(Br)cc(F)c(F)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H13BrF2O2.C11H11BrF2O3/c1-6-7(13)5-8(14)10(15)9(6)11(16)17-12(2,3)4;1-11(2,3)17-10(16)7-8(14)6(13)4-5(12)9(7)15/h5H,1-4H3;4,15H,1-3H3 |
| InChIKey | UTBHHSZDEQZJRJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.24 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|