C37H52BF4 — CID 161186786
CID 161186786 (PubChem CID 161186786) has the molecular formula C37H52BF4 and a molecular weight of 583.63 g/mol.
| Compound Name | CID 161186786 |
|---|---|
| PubChem CID | 161186786 |
| Molecular Formula | C37H52BF4 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | — |
| SMILES | Cc1ccc(CC2CCC(C)CC2)c(F)c1F.Cc1ccc(CC2CCC(CC3CCC(C)CC3)CC2)c(F)c1F.[B] |
| InChI | InChI=1S/C22H32F2.C15H20F2.B/c1-15-3-6-17(7-4-15)13-18-8-10-19(11-9-18)14-20-12-5-16(2)21(23)22(20)24;1-10-3-6-12(7-4-10)9-13-8-5-11(2)14(16)15(13)17;/h5,12,15,17-19H,3-4,6-11,13-14H2,1-2H3;5,8,10,12H,3-4,6-7,9H2,1-2H3; |
| InChIKey | UIVVIHKLFMCVAE-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|