C23H20F2N4O3 — CID 161187171
2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 161187171) has the molecular formula C23H20F2N4O3 and a molecular weight of 438.43 g/mol. Its IUPAC name is 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 161187171 |
| Molecular Formula | C23H20F2N4O3 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1nc(-c2ccc(F)cc2F)ccc1[N+](=O)[O-])N1CCC(Cc2cccnc2)C1 |
| InChI | InChI=1S/C23H20F2N4O3/c24-17-3-4-18(19(25)11-17)20-5-6-22(29(31)32)21(27-20)12-23(30)28-9-7-16(14-28)10-15-2-1-8-26-13-15/h1-6,8,11,13,16H,7,9-10,12,14H2 |
| InChIKey | UYUYJOXQDHHQQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|